About [1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol
[1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol (PubChem CID 141350781) has the molecular formula C8H13N5O
and a molecular weight of 195.23 g/mol. Its IUPAC name is [1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol |
| PubChem CID | 141350781 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | [1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol |
| SMILES | Nc1ncnc(N2CCCC2CO)n1 |
| InChI | InChI=1S/C8H13N5O/c9-7-10-5-11-8(12-7)13-3-1-2-6(13)4-14/h5-6,14H,1-4H2,(H2,9,10,11,12) |
| InChIKey | RVWMTNXXKGSJDA-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol?
The IUPAC name of [1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol (CID 141350781) is [1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol.
What is the SMILES notation for [1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol?
The canonical SMILES for [1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol is Nc1ncnc(N2CCCC2CO)n1.
What is the InChIKey of [1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol?
The InChIKey is RVWMTNXXKGSJDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O/c9-7-10-5-11-8(12-7)13-3-1-2-6(13)4-14/h5-6,14H,1-4H2,(H2,9,10,11,12).
What are the key properties of [1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol?
[1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol has a molecular weight of 195.23 g/mol, XLogP of -0.59, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-amino-1,3,5-triazin-2-yl)pyrrolidin-2-yl]methanol is sourced from PubChem (CID 141350781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).