C25H32N2O3S — CID 141351208
2-[5-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ylmethyl)-2-methoxyphenyl]sulfonyl-3,4-dihydro-1H-isoquinoline (PubChem CID 141351208) has the molecular formula C25H32N2O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is 2-[5-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ylmethyl)-2-methoxyphenyl]sulfonyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[5-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ylmethyl)-2-methoxyphenyl]sulfonyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 141351208 |
| Molecular Formula | C25H32N2O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2-[5-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ylmethyl)-2-methoxyphenyl]sulfonyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc(CN2CC3CCCCC3C2)cc1S(=O)(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C25H32N2O3S/c1-30-24-11-10-19(15-26-16-21-7-4-5-8-22(21)17-26)14-25(24)31(28,29)27-13-12-20-6-2-3-9-23(20)18-27/h2-3,6,9-11,14,21-22H,4-5,7-8,12-13,15-18H2,1H3 |
| InChIKey | AMRUYTLGUJZICD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |