C11H12ClNO2 — CID 141351291
(2S)-2-(4-chlorophenyl)pyrrolidine-2-carboxylic acid (PubChem CID 141351291) has the molecular formula C11H12ClNO2 and a molecular weight of 225.68 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-2-(4-chlorophenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 141351291 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@]1(c2ccc(Cl)cc2)CCCN1 |
| InChI | InChI=1S/C11H12ClNO2/c12-9-4-2-8(3-5-9)11(10(14)15)6-1-7-13-11/h2-5,13H,1,6-7H2,(H,14,15)/t11-/m0/s1 |
| InChIKey | ZKYGLLKKGCYRNH-NSHDSACASA-N |
| XLogP | 2.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |