C22H15N3O2 — CID 141351984
1-benzyl-5-hydroxy-2-oxo-3-phenyl-1,7-naphthyridine-8-carbonitrile (PubChem CID 141351984) has the molecular formula C22H15N3O2 and a molecular weight of 353.38 g/mol. Its IUPAC name is 1-benzyl-5-hydroxy-2-oxo-3-phenyl-1,7-naphthyridine-8-carbonitrile.
| Compound Name | 1-benzyl-5-hydroxy-2-oxo-3-phenyl-1,7-naphthyridine-8-carbonitrile |
|---|---|
| PubChem CID | 141351984 |
| Molecular Formula | C22H15N3O2 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-benzyl-5-hydroxy-2-oxo-3-phenyl-1,7-naphthyridine-8-carbonitrile |
| SMILES | N#Cc1ncc(O)c2cc(-c3ccccc3)c(=O)n(Cc3ccccc3)c12 |
| InChI | InChI=1S/C22H15N3O2/c23-12-19-21-18(20(26)13-24-19)11-17(16-9-5-2-6-10-16)22(27)25(21)14-15-7-3-1-4-8-15/h1-11,13,26H,14H2 |
| InChIKey | UFQGMVNZOXXQDZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |