C20H14FN3O2 — CID 141351985
2-benzyl-8-(5-fluoro-3-pyridinyl)-5-hydroxy-2,7-naphthyridin-1-one (PubChem CID 141351985) has the molecular formula C20H14FN3O2 and a molecular weight of 347.35 g/mol. Its IUPAC name is 2-benzyl-8-(5-fluoro-3-pyridinyl)-5-hydroxy-2,7-naphthyridin-1-one.
| Compound Name | 2-benzyl-8-(5-fluoro-3-pyridinyl)-5-hydroxy-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 141351985 |
| Molecular Formula | C20H14FN3O2 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-benzyl-8-(5-fluoro-3-pyridinyl)-5-hydroxy-2,7-naphthyridin-1-one |
| SMILES | O=c1c2c(-c3cncc(F)c3)ncc(O)c2ccn1Cc1ccccc1 |
| InChI | InChI=1S/C20H14FN3O2/c21-15-8-14(9-22-10-15)19-18-16(17(25)11-23-19)6-7-24(20(18)26)12-13-4-2-1-3-5-13/h1-11,25H,12H2 |
| InChIKey | RDCLYEPCUGGJAZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|