C12H18N4OS — CID 141352322
4-(4,4-diaminocyclohexa-1,5-dien-1-yl)sulfinylcyclohexa-2,4-diene-1,1-diamine (PubChem CID 141352322) has the molecular formula C12H18N4OS and a molecular weight of 266.37 g/mol. Its IUPAC name is 4-(4,4-diaminocyclohexa-1,5-dien-1-yl)sulfinylcyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 4-(4,4-diaminocyclohexa-1,5-dien-1-yl)sulfinylcyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 141352322 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 4-(4,4-diaminocyclohexa-1,5-dien-1-yl)sulfinylcyclohexa-2,4-diene-1,1-diamine |
| SMILES | NC1(N)C=CC(S(=O)C2=CCC(N)(N)C=C2)=CC1 |
| InChI | InChI=1S/C12H18N4OS/c13-11(14)5-1-9(2-6-11)18(17)10-3-7-12(15,16)8-4-10/h1-5,7H,6,8,13-16H2 |
| InChIKey | QHHHJDAYUWJKIL-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|