C17H19NO3 — CID 141352356
1-[(2E)-2-[(3-methoxyphenyl)methylidene]butanoyl]-2,3-dihydropyridin-6-one (PubChem CID 141352356) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-[(2E)-2-[(3-methoxyphenyl)methylidene]butanoyl]-2,3-dihydropyridin-6-one.
| Compound Name | 1-[(2E)-2-[(3-methoxyphenyl)methylidene]butanoyl]-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 141352356 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 1-[(2E)-2-[(3-methoxyphenyl)methylidene]butanoyl]-2,3-dihydropyridin-6-one |
| SMILES | CC/C(=C\c1cccc(OC)c1)C(=O)N1CCC=CC1=O |
| InChI | InChI=1S/C17H19NO3/c1-3-14(11-13-7-6-8-15(12-13)21-2)17(20)18-10-5-4-9-16(18)19/h4,6-9,11-12H,3,5,10H2,1-2H3/b14-11+ |
| InChIKey | BKSOZVAWUHCXGV-SDNWHVSQSA-N |
| XLogP | 2.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|