About 3,4,6,7-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine
3,4,6,7-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine (PubChem CID 141353849) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 3,4,6,7-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine.
Analyze 3,4,6,7-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,6,7-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine?
The IUPAC name of 3,4,6,7-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine (CID 141353849) is 3,4,6,7-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine.
What is the SMILES notation for 3,4,6,7-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine?
The canonical SMILES for 3,4,6,7-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine is C1=C2COCCN2CC1.
What is the InChIKey of 3,4,6,7-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine?
The InChIKey is LOPHOJNWUJFSOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-2-7-6-9-5-4-8(7)3-1/h2H,1,3-6H2.
What are the key properties of 3,4,6,7-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine?
3,4,6,7-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine has a molecular weight of 125.17 g/mol, XLogP of 0.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,6,7-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazine is sourced from PubChem (CID 141353849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).