About 1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea
1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea (PubChem CID 141353895) has the molecular formula C22H20N4O2
and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea.
Molecular Properties
| Compound Name | 1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea |
| PubChem CID | 141353895 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea |
| SMILES | CC1CCc2cc(-c3ncc(NC(=O)Nc4ccccc4)cn3)ccc2C1=O |
| InChI | InChI=1S/C22H20N4O2/c1-14-7-8-15-11-16(9-10-19(15)20(14)27)21-23-12-18(13-24-21)26-22(28)25-17-5-3-2-4-6-17/h2-6,9-14H,7-8H2,1H3,(H2,25,26,28) |
| InChIKey | QTSLWCXJIUEEPW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea?
The IUPAC name of 1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea (CID 141353895) is 1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea.
What is the SMILES notation for 1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea?
The canonical SMILES for 1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea is CC1CCc2cc(-c3ncc(NC(=O)Nc4ccccc4)cn3)ccc2C1=O.
What is the InChIKey of 1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea?
The InChIKey is QTSLWCXJIUEEPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4O2/c1-14-7-8-15-11-16(9-10-19(15)20(14)27)21-23-12-18(13-24-21)26-22(28)25-17-5-3-2-4-6-17/h2-6,9-14H,7-8H2,1H3,(H2,25,26,28).
What are the key properties of 1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea?
1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea has a molecular weight of 372.43 g/mol, XLogP of 4.55, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(6-methyl-5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrimidin-5-yl]-3-phenylurea is sourced from PubChem (CID 141353895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).