About 2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate
2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate (PubChem CID 141354214) has the molecular formula C17H34O3
and a molecular weight of 286.46 g/mol. Its IUPAC name is 2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate.
Molecular Properties
| Compound Name | 2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate |
| PubChem CID | 141354214 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | 2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate |
| SMILES | CCCC(C)(C)OCC(C)(C)C(=O)OC(C)(C)CCC |
| InChI | InChI=1S/C17H34O3/c1-9-11-16(5,6)19-13-15(3,4)14(18)20-17(7,8)12-10-2/h9-13H2,1-8H3 |
| InChIKey | IUILGOWSEHMZJB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate?
The IUPAC name of 2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate (CID 141354214) is 2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate.
What is the SMILES notation for 2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate?
The canonical SMILES for 2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate is CCCC(C)(C)OCC(C)(C)C(=O)OC(C)(C)CCC.
What is the InChIKey of 2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate?
The InChIKey is IUILGOWSEHMZJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O3/c1-9-11-16(5,6)19-13-15(3,4)14(18)20-17(7,8)12-10-2/h9-13H2,1-8H3.
What are the key properties of 2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate?
2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate has a molecular weight of 286.46 g/mol, XLogP of 4.73, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentan-2-yl 2,2-dimethyl-3-(2-methylpentan-2-yloxy)propanoate is sourced from PubChem (CID 141354214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).