C12H21N3 — CID 141354273
1,3,5-tris(prop-1-enyl)-1,3,5-triazinane (PubChem CID 141354273) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 1,3,5-tris(prop-1-enyl)-1,3,5-triazinane.
| Compound Name | 1,3,5-tris(prop-1-enyl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 141354273 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 1,3,5-tris(prop-1-enyl)-1,3,5-triazinane |
| SMILES | CC=CN1CN(C=CC)CN(C=CC)C1 |
| InChI | InChI=1S/C12H21N3/c1-4-7-13-10-14(8-5-2)12-15(11-13)9-6-3/h4-9H,10-12H2,1-3H3 |
| InChIKey | OCJFMPGJEGCRAH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |