About 3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide
3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide (PubChem CID 141354500) has the molecular formula C15H11Cl2N3O4S2
and a molecular weight of 432.31 g/mol. Its IUPAC name is 3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide |
| PubChem CID | 141354500 |
| Molecular Formula | C15H11Cl2N3O4S2 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | 3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide |
| SMILES | N#Cc1cccc(S(N)(=O)=O)c1NS(=O)(=O)C=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2N3O4S2/c16-12-5-4-10(8-13(12)17)6-7-25(21,22)20-15-11(9-18)2-1-3-14(15)26(19,23)24/h1-8,20H,(H2,19,23,24) |
| InChIKey | AFBWYQYVYPRFLN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 130.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide?
The IUPAC name of 3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide (CID 141354500) is 3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide.
What is the SMILES notation for 3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide?
The canonical SMILES for 3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide is N#Cc1cccc(S(N)(=O)=O)c1NS(=O)(=O)C=Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide?
The InChIKey is AFBWYQYVYPRFLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2N3O4S2/c16-12-5-4-10(8-13(12)17)6-7-25(21,22)20-15-11(9-18)2-1-3-14(15)26(19,23)24/h1-8,20H,(H2,19,23,24).
What are the key properties of 3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide?
3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide has a molecular weight of 432.31 g/mol, XLogP of 2.93, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-2-[2-(3,4-dichlorophenyl)ethenylsulfonylamino]benzenesulfonamide is sourced from PubChem (CID 141354500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).