C14H11ClN4O — CID 141354765
2-amino-6-(2-chlorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 141354765) has the molecular formula C14H11ClN4O and a molecular weight of 286.72 g/mol. Its IUPAC name is 2-amino-6-(2-chlorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-amino-6-(2-chlorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 141354765 |
| Molecular Formula | C14H11ClN4O |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-amino-6-(2-chlorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cn1c(=O)c(-c2ccccc2Cl)cc2cnc(N)nc21 |
| InChI | InChI=1S/C14H11ClN4O/c1-19-12-8(7-17-14(16)18-12)6-10(13(19)20)9-4-2-3-5-11(9)15/h2-7H,1H3,(H2,16,17,18) |
| InChIKey | WTIZFUYXJLCTEM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |