C21H33F2NO3 — CID 141355734
N-[3,3-difluoro-1-hydroxy-2-(hydroxymethyl)-4-(4-octylphenyl)butan-2-yl]acetamide (PubChem CID 141355734) has the molecular formula C21H33F2NO3 and a molecular weight of 385.50 g/mol. Its IUPAC name is N-[3,3-difluoro-1-hydroxy-2-(hydroxymethyl)-4-(4-octylphenyl)butan-2-yl]acetamide.
| Compound Name | N-[3,3-difluoro-1-hydroxy-2-(hydroxymethyl)-4-(4-octylphenyl)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 141355734 |
| Molecular Formula | C21H33F2NO3 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-[3,3-difluoro-1-hydroxy-2-(hydroxymethyl)-4-(4-octylphenyl)butan-2-yl]acetamide |
| SMILES | CCCCCCCCc1ccc(CC(F)(F)C(CO)(CO)NC(C)=O)cc1 |
| InChI | InChI=1S/C21H33F2NO3/c1-3-4-5-6-7-8-9-18-10-12-19(13-11-18)14-21(22,23)20(15-25,16-26)24-17(2)27/h10-13,25-26H,3-9,14-16H2,1-2H3,(H,24,27) |
| InChIKey | LSYMQGSFKBJNDC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|