C12H2F16O5 — CID 141355827
2-(1-carboxy-2,3,3,4,4,5,5,5-octafluoropent-1-enoxy)-3,4,4,5,5,6,6,6-octafluorohex-2-enoic acid (PubChem CID 141355827) has the molecular formula C12H2F16O5 and a molecular weight of 530.11 g/mol. Its IUPAC name is 2-(1-carboxy-2,3,3,4,4,5,5,5-octafluoropent-1-enoxy)-3,4,4,5,5,6,6,6-octafluorohex-2-enoic acid.
| Compound Name | 2-(1-carboxy-2,3,3,4,4,5,5,5-octafluoropent-1-enoxy)-3,4,4,5,5,6,6,6-octafluorohex-2-enoic acid |
|---|---|
| PubChem CID | 141355827 |
| Molecular Formula | C12H2F16O5 |
| Molecular Weight | 530.11 g/mol |
| Exact Mass | 529.96 |
| IUPAC Name | 2-(1-carboxy-2,3,3,4,4,5,5,5-octafluoropent-1-enoxy)-3,4,4,5,5,6,6,6-octafluorohex-2-enoic acid |
| SMILES | O=C(O)C(OC(C(=O)O)=C(F)C(F)(F)C(F)(F)C(F)(F)F)=C(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H2F16O5/c13-3(7(15,16)9(19,20)11(23,24)25)1(5(29)30)33-2(6(31)32)4(14)8(17,18)10(21,22)12(26,27)28/h(H,29,30)(H,31,32) |
| InChIKey | RRIYONPMUMBHPF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.11 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|