About N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide
N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide (PubChem CID 141356074) has the molecular formula C20H20N2O3
and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide |
| PubChem CID | 141356074 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide |
| SMILES | CC(=O)NC1(c2ccc(C(C)C)cc2)C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C20H20N2O3/c1-11(2)13-7-9-14(10-8-13)20(22-12(3)23)18(24)15-5-4-6-16(21)17(15)19(20)25/h4-11H,21H2,1-3H3,(H,22,23) |
| InChIKey | YWKNXIYGKCPULL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide?
The IUPAC name of N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide (CID 141356074) is N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide.
What is the SMILES notation for N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide?
The canonical SMILES for N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide is CC(=O)NC1(c2ccc(C(C)C)cc2)C(=O)c2cccc(N)c2C1=O.
What is the InChIKey of N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide?
The InChIKey is YWKNXIYGKCPULL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O3/c1-11(2)13-7-9-14(10-8-13)20(22-12(3)23)18(24)15-5-4-6-16(21)17(15)19(20)25/h4-11H,21H2,1-3H3,(H,22,23).
What are the key properties of N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide?
N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide has a molecular weight of 336.39 g/mol, XLogP of 2.80, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-amino-1,3-dioxo-2-(4-propan-2-ylphenyl)inden-2-yl]acetamide is sourced from PubChem (CID 141356074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).