C17H16ClN5O3 — CID 141356354
3-(2-chloro-4-nitrophenyl)-1-(2,3-dimethylindazol-6-yl)-1-methylurea (PubChem CID 141356354) has the molecular formula C17H16ClN5O3 and a molecular weight of 373.80 g/mol. Its IUPAC name is 3-(2-chloro-4-nitrophenyl)-1-(2,3-dimethylindazol-6-yl)-1-methylurea.
| Compound Name | 3-(2-chloro-4-nitrophenyl)-1-(2,3-dimethylindazol-6-yl)-1-methylurea |
|---|---|
| PubChem CID | 141356354 |
| Molecular Formula | C17H16ClN5O3 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 3-(2-chloro-4-nitrophenyl)-1-(2,3-dimethylindazol-6-yl)-1-methylurea |
| SMILES | Cc1c2ccc(N(C)C(=O)Nc3ccc([N+](=O)[O-])cc3Cl)cc2nn1C |
| InChI | InChI=1S/C17H16ClN5O3/c1-10-13-6-4-11(9-16(13)20-22(10)3)21(2)17(24)19-15-7-5-12(23(25)26)8-14(15)18/h4-9H,1-3H3,(H,19,24) |
| InChIKey | NFUBNJCJWQXLLQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|