C22H16ClN3O3S — CID 1413573
2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone (PubChem CID 1413573) has the molecular formula C22H16ClN3O3S and a molecular weight of 437.91 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 1413573 |
| Molecular Formula | C22H16ClN3O3S |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccccc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C22H16ClN3O3S/c23-16-9-6-14(7-10-16)21-24-25-22(26(21)17-4-2-1-3-5-17)30-13-20(29)15-8-11-18(27)19(28)12-15/h1-12,27-28H,13H2 |
| InChIKey | OAZGQPCGRCLPNM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|