C10H3F13O2 — CID 141357327
methyl 3,3-difluoro-2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)prop-2-enoate (PubChem CID 141357327) has the molecular formula C10H3F13O2 and a molecular weight of 402.11 g/mol. Its IUPAC name is methyl 3,3-difluoro-2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)prop-2-enoate.
| Compound Name | methyl 3,3-difluoro-2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)prop-2-enoate |
|---|---|
| PubChem CID | 141357327 |
| Molecular Formula | C10H3F13O2 |
| Molecular Weight | 402.11 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | methyl 3,3-difluoro-2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)prop-2-enoate |
| SMILES | COC(=O)C(=C(F)F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H3F13O2/c1-25-4(24)2(3(11)12)5(13)6(14,15)8(18,19)10(22,23)9(20,21)7(5,16)17/h1H3 |
| InChIKey | ORDFVUTYPOTWHK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.11 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|