About [(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate
[(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate (PubChem CID 141358363) has the molecular formula C23H29NO3
and a molecular weight of 367.49 g/mol. Its IUPAC name is [(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate.
Molecular Properties
| Compound Name | [(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate |
| PubChem CID | 141358363 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | [(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate |
| SMILES | CC[C@@]1(c2cccc(O)c2)CN(C)CCC[C@H]1OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO3/c1-3-23(19-11-7-12-20(25)16-19)17-24(2)14-8-13-21(23)27-22(26)15-18-9-5-4-6-10-18/h4-7,9-12,16,21,25H,3,8,13-15,17H2,1-2H3/t21-,23+/m1/s1 |
| InChIKey | YMTYZPVDNDPPLC-GGAORHGYSA-N |
| XLogP | 3.92 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate?
The IUPAC name of [(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate (CID 141358363) is [(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate.
What is the SMILES notation for [(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate?
The canonical SMILES for [(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate is CC[C@@]1(c2cccc(O)c2)CN(C)CCC[C@H]1OC(=O)Cc1ccccc1.
What is the InChIKey of [(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate?
The InChIKey is YMTYZPVDNDPPLC-GGAORHGYSA-N. The full InChI is InChI=1S/C23H29NO3/c1-3-23(19-11-7-12-20(25)16-19)17-24(2)14-8-13-21(23)27-22(26)15-18-9-5-4-6-10-18/h4-7,9-12,16,21,25H,3,8,13-15,17H2,1-2H3/t21-,23+/m1/s1.
What are the key properties of [(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate?
[(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate has a molecular weight of 367.49 g/mol, XLogP of 3.92, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-3-ethyl-3-(3-hydroxyphenyl)-1-methylazepan-4-yl] 2-phenylacetate is sourced from PubChem (CID 141358363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).