C17H32N4O3 — CID 141358869
tert-butyl N-[1-[2-(4-methylpiperazin-1-yl)acetyl]piperidin-4-yl]carbamate (PubChem CID 141358869) has the molecular formula C17H32N4O3 and a molecular weight of 340.47 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(4-methylpiperazin-1-yl)acetyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(4-methylpiperazin-1-yl)acetyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 141358869 |
| Molecular Formula | C17H32N4O3 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | tert-butyl N-[1-[2-(4-methylpiperazin-1-yl)acetyl]piperidin-4-yl]carbamate |
| SMILES | CN1CCN(CC(=O)N2CCC(NC(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C17H32N4O3/c1-17(2,3)24-16(23)18-14-5-7-21(8-6-14)15(22)13-20-11-9-19(4)10-12-20/h14H,5-13H2,1-4H3,(H,18,23) |
| InChIKey | FLJQSIDHDCIOOB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |