About 1-cyclohexa-1,5-dien-1-yl-4-methylimidazole
1-cyclohexa-1,5-dien-1-yl-4-methylimidazole (PubChem CID 141359437) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-4-methylimidazole.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-4-methylimidazole |
| PubChem CID | 141359437 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-4-methylimidazole |
| SMILES | Cc1cn(C2=CCCC=C2)cn1 |
| InChI | InChI=1S/C10H12N2/c1-9-7-12(8-11-9)10-5-3-2-4-6-10/h3,5-8H,2,4H2,1H3 |
| InChIKey | OSYGKOWQDCGHDZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexa-1,5-dien-1-yl-4-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-yl-4-methylimidazole?
The IUPAC name of 1-cyclohexa-1,5-dien-1-yl-4-methylimidazole (CID 141359437) is 1-cyclohexa-1,5-dien-1-yl-4-methylimidazole.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-yl-4-methylimidazole?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-yl-4-methylimidazole is Cc1cn(C2=CCCC=C2)cn1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-yl-4-methylimidazole?
The InChIKey is OSYGKOWQDCGHDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-9-7-12(8-11-9)10-5-3-2-4-6-10/h3,5-8H,2,4H2,1H3.
What are the key properties of 1-cyclohexa-1,5-dien-1-yl-4-methylimidazole?
1-cyclohexa-1,5-dien-1-yl-4-methylimidazole has a molecular weight of 160.22 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-yl-4-methylimidazole is sourced from PubChem (CID 141359437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).