C39H56N2O4S — CID 141359673
3-[4-[(E)-2-[4-(diethylamino)butylamino]oxyethenyl]-2-methoxyphenyl]-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzoic acid (PubChem CID 141359673) has the molecular formula C39H56N2O4S and a molecular weight of 648.95 g/mol. Its IUPAC name is 3-[4-[(E)-2-[4-(diethylamino)butylamino]oxyethenyl]-2-methoxyphenyl]-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzoic acid.
| Compound Name | 3-[4-[(E)-2-[4-(diethylamino)butylamino]oxyethenyl]-2-methoxyphenyl]-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 141359673 |
| Molecular Formula | C39H56N2O4S |
| Molecular Weight | 648.95 g/mol |
| Exact Mass | 648.40 |
| IUPAC Name | 3-[4-[(E)-2-[4-(diethylamino)butylamino]oxyethenyl]-2-methoxyphenyl]-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzoic acid |
| SMILES | CCN(CC)CCCCNO/C=C/c1ccc(-c2cccc(C(=O)O)c2SCC=C(C)CCC=C(C)CCC=C(C)C)c(OC)c1 |
| InChI | InChI=1S/C39H56N2O4S/c1-8-41(9-2)26-11-10-25-40-45-27-23-33-21-22-34(37(29-33)44-7)35-19-14-20-36(39(42)43)38(35)46-28-24-32(6)18-13-17-31(5)16-12-15-30(3)4/h14-15,17,19-24,27,29,40H,8-13,16,18,25-26,28H2,1-7H3,(H,42,43)/b27-23+,31-17?,32-24? |
| InChIKey | SUHHCZIATSJEHH-BFIRRVCUSA-N |
| XLogP | 10.19 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.95 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|