About 5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine
5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine (PubChem CID 141359883) has the molecular formula C20H15F3N4
and a molecular weight of 368.36 g/mol. Its IUPAC name is 5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine |
| PubChem CID | 141359883 |
| Molecular Formula | C20H15F3N4 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine |
| SMILES | FC(F)(F)c1ccccc1Nc1ccc(Cc2c[nH]c3ncccc23)cn1 |
| InChI | InChI=1S/C20H15F3N4/c21-20(22,23)16-5-1-2-6-17(16)27-18-8-7-13(11-25-18)10-14-12-26-19-15(14)4-3-9-24-19/h1-9,11-12H,10H2,(H,24,26)(H,25,27) |
| InChIKey | AGKCZVNAATYAHL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine?
The IUPAC name of 5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine (CID 141359883) is 5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine.
What is the SMILES notation for 5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine?
The canonical SMILES for 5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine is FC(F)(F)c1ccccc1Nc1ccc(Cc2c[nH]c3ncccc23)cn1.
What is the InChIKey of 5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine?
The InChIKey is AGKCZVNAATYAHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F3N4/c21-20(22,23)16-5-1-2-6-17(16)27-18-8-7-13(11-25-18)10-14-12-26-19-15(14)4-3-9-24-19/h1-9,11-12H,10H2,(H,24,26)(H,25,27).
What are the key properties of 5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine?
5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine has a molecular weight of 368.36 g/mol, XLogP of 5.31, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-N-[2-(trifluoromethyl)phenyl]pyridin-2-amine is sourced from PubChem (CID 141359883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).