C21H26O5 — CID 141361078
3-ethyl-1,4-dioxo-8-(phenylmethoxymethyl)spiro[4.5]decane-8-carboxylic acid (PubChem CID 141361078) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is 3-ethyl-1,4-dioxo-8-(phenylmethoxymethyl)spiro[4.5]decane-8-carboxylic acid.
| Compound Name | 3-ethyl-1,4-dioxo-8-(phenylmethoxymethyl)spiro[4.5]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 141361078 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-ethyl-1,4-dioxo-8-(phenylmethoxymethyl)spiro[4.5]decane-8-carboxylic acid |
| SMILES | CCC1CC(=O)C2(CCC(COCc3ccccc3)(C(=O)O)CC2)C1=O |
| InChI | InChI=1S/C21H26O5/c1-2-16-12-17(22)21(18(16)23)10-8-20(9-11-21,19(24)25)14-26-13-15-6-4-3-5-7-15/h3-7,16H,2,8-14H2,1H3,(H,24,25) |
| InChIKey | MBYSLAZFXPQKSS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|