About azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate
azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate (PubChem CID 141361589) has the molecular formula C7H19NO4S
and a molecular weight of 213.30 g/mol. Its IUPAC name is azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate.
Molecular Properties
| Compound Name | azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate |
| PubChem CID | 141361589 |
| Molecular Formula | C7H19NO4S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate |
| SMILES | CC(C)(C)C(CCO)S(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C7H16O4S.H3N/c1-7(2,3)6(4-5-8)12(9,10)11;/h6,8H,4-5H2,1-3H3,(H,9,10,11);1H3 |
| InChIKey | VZMYRDGDKWEKDA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate?
The IUPAC name of azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate (CID 141361589) is azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate.
What is the SMILES notation for azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate?
The canonical SMILES for azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate is CC(C)(C)C(CCO)S(=O)(=O)[O-].[NH4+].
What is the InChIKey of azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate?
The InChIKey is VZMYRDGDKWEKDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O4S.H3N/c1-7(2,3)6(4-5-8)12(9,10)11;/h6,8H,4-5H2,1-3H3,(H,9,10,11);1H3.
What are the key properties of azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate?
azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate has a molecular weight of 213.30 g/mol, XLogP of 0.70, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 1-hydroxy-4,4-dimethylpentane-3-sulfonate is sourced from PubChem (CID 141361589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).