C15H25ClN2O2 — CID 141361844
N-[[2-(3-butoxyphenyl)ethylamino]methyl]acetamide;hydrochloride (PubChem CID 141361844) has the molecular formula C15H25ClN2O2 and a molecular weight of 300.83 g/mol. Its IUPAC name is N-[[2-(3-butoxyphenyl)ethylamino]methyl]acetamide;hydrochloride.
| Compound Name | N-[[2-(3-butoxyphenyl)ethylamino]methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 141361844 |
| Molecular Formula | C15H25ClN2O2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[[2-(3-butoxyphenyl)ethylamino]methyl]acetamide;hydrochloride |
| SMILES | CCCCOc1cccc(CCNCNC(C)=O)c1.Cl |
| InChI | InChI=1S/C15H24N2O2.ClH/c1-3-4-10-19-15-7-5-6-14(11-15)8-9-16-12-17-13(2)18;/h5-7,11,16H,3-4,8-10,12H2,1-2H3,(H,17,18);1H |
| InChIKey | ILHMWTVULQEGBY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|