About 5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine
5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine (PubChem CID 141362078) has the molecular formula C22H19N3S
and a molecular weight of 357.48 g/mol. Its IUPAC name is 5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine.
Molecular Properties
| Compound Name | 5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine |
| PubChem CID | 141362078 |
| Molecular Formula | C22H19N3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine |
| SMILES | c1cc2c(c(-c3ccncc3)c1)CN(CCc1ccc3sccc3n1)C2 |
| InChI | InChI=1S/C22H19N3S/c1-2-17-14-25(12-8-18-4-5-22-21(24-18)9-13-26-22)15-20(17)19(3-1)16-6-10-23-11-7-16/h1-7,9-11,13H,8,12,14-15H2 |
| InChIKey | GJLITBLUXJVXJI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine?
The IUPAC name of 5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine (CID 141362078) is 5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine.
What is the SMILES notation for 5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine?
The canonical SMILES for 5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine is c1cc2c(c(-c3ccncc3)c1)CN(CCc1ccc3sccc3n1)C2.
What is the InChIKey of 5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine?
The InChIKey is GJLITBLUXJVXJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3S/c1-2-17-14-25(12-8-18-4-5-22-21(24-18)9-13-26-22)15-20(17)19(3-1)16-6-10-23-11-7-16/h1-7,9-11,13H,8,12,14-15H2.
What are the key properties of 5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine?
5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine has a molecular weight of 357.48 g/mol, XLogP of 4.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-pyridin-4-yl-1,3-dihydroisoindol-2-yl)ethyl]thieno[3,2-b]pyridine is sourced from PubChem (CID 141362078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).