C11H14N2O — CID 141362869
3-(2-methoxy-6-methylphenyl)-1,2-dihydroimidazole (PubChem CID 141362869) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-(2-methoxy-6-methylphenyl)-1,2-dihydroimidazole.
| Compound Name | 3-(2-methoxy-6-methylphenyl)-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 141362869 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 3-(2-methoxy-6-methylphenyl)-1,2-dihydroimidazole |
| SMILES | COc1cccc(C)c1N1C=CNC1 |
| InChI | InChI=1S/C11H14N2O/c1-9-4-3-5-10(14-2)11(9)13-7-6-12-8-13/h3-7,12H,8H2,1-2H3 |
| InChIKey | HSOHZQGEXAJLFV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |