About 3-prop-1-enylindol-2-one;hydrochloride
3-prop-1-enylindol-2-one;hydrochloride (PubChem CID 141362920) has the molecular formula C11H10ClNO
and a molecular weight of 207.66 g/mol. Its IUPAC name is 3-prop-1-enylindol-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-prop-1-enylindol-2-one;hydrochloride |
| PubChem CID | 141362920 |
| Molecular Formula | C11H10ClNO |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 3-prop-1-enylindol-2-one;hydrochloride |
| SMILES | CC=CC1=c2ccccc2=NC1=O.Cl |
| InChI | InChI=1S/C11H9NO.ClH/c1-2-5-9-8-6-3-4-7-10(8)12-11(9)13;/h2-7H,1H3;1H |
| InChIKey | YSHSUFHENRLPKT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-prop-1-enylindol-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-1-enylindol-2-one;hydrochloride?
The IUPAC name of 3-prop-1-enylindol-2-one;hydrochloride (CID 141362920) is 3-prop-1-enylindol-2-one;hydrochloride.
What is the SMILES notation for 3-prop-1-enylindol-2-one;hydrochloride?
The canonical SMILES for 3-prop-1-enylindol-2-one;hydrochloride is CC=CC1=c2ccccc2=NC1=O.Cl.
What is the InChIKey of 3-prop-1-enylindol-2-one;hydrochloride?
The InChIKey is YSHSUFHENRLPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO.ClH/c1-2-5-9-8-6-3-4-7-10(8)12-11(9)13;/h2-7H,1H3;1H.
What are the key properties of 3-prop-1-enylindol-2-one;hydrochloride?
3-prop-1-enylindol-2-one;hydrochloride has a molecular weight of 207.66 g/mol, XLogP of 1.00, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-1-enylindol-2-one;hydrochloride is sourced from PubChem (CID 141362920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).