C28H31N3O4 — CID 141363455
N-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-9H-xanthene-9-carboxamide (PubChem CID 141363455) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is N-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 141363455 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | N-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-9H-xanthene-9-carboxamide |
| SMILES | COc1ccccc1N1CCN(CC(O)CNC(=O)C2c3ccccc3Oc3ccccc32)CC1 |
| InChI | InChI=1S/C28H31N3O4/c1-34-26-13-7-4-10-23(26)31-16-14-30(15-17-31)19-20(32)18-29-28(33)27-21-8-2-5-11-24(21)35-25-12-6-3-9-22(25)27/h2-13,20,27,32H,14-19H2,1H3,(H,29,33) |
| InChIKey | QEQNKGOWSSYUMD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |