C9H14N4O — CID 141363746
3-amino-1-(1H-imidazol-2-ylmethyl)piperidin-2-one (PubChem CID 141363746) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 3-amino-1-(1H-imidazol-2-ylmethyl)piperidin-2-one.
| Compound Name | 3-amino-1-(1H-imidazol-2-ylmethyl)piperidin-2-one |
|---|---|
| PubChem CID | 141363746 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 3-amino-1-(1H-imidazol-2-ylmethyl)piperidin-2-one |
| SMILES | NC1CCCN(Cc2ncc[nH]2)C1=O |
| InChI | InChI=1S/C9H14N4O/c10-7-2-1-5-13(9(7)14)6-8-11-3-4-12-8/h3-4,7H,1-2,5-6,10H2,(H,11,12) |
| InChIKey | HFRMJSGCPISMCP-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |