About [2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol
[2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol (PubChem CID 141363838) has the molecular formula C10H12N2OS
and a molecular weight of 208.29 g/mol. Its IUPAC name is [2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol.
Molecular Properties
| Compound Name | [2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol |
| PubChem CID | 141363838 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | [2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol |
| SMILES | Nc1ccccc1C1=NC(CO)CS1 |
| InChI | InChI=1S/C10H12N2OS/c11-9-4-2-1-3-8(9)10-12-7(5-13)6-14-10/h1-4,7,13H,5-6,11H2 |
| InChIKey | RVGHWPBZHJDNGP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol?
The IUPAC name of [2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol (CID 141363838) is [2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol.
What is the SMILES notation for [2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol?
The canonical SMILES for [2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol is Nc1ccccc1C1=NC(CO)CS1.
What is the InChIKey of [2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol?
The InChIKey is RVGHWPBZHJDNGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2OS/c11-9-4-2-1-3-8(9)10-12-7(5-13)6-14-10/h1-4,7,13H,5-6,11H2.
What are the key properties of [2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol?
[2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol has a molecular weight of 208.29 g/mol, XLogP of 1.12, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-aminophenyl)-4,5-dihydro-1,3-thiazol-4-yl]methanol is sourced from PubChem (CID 141363838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).