About 1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol
1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol (PubChem CID 141364615) has the molecular formula C17H26N2O3
and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol |
| PubChem CID | 141364615 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol |
| SMILES | COc1ccc([C@@]2(O)CNC[C@H]2CN2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C17H26N2O3/c1-22-16-4-2-13(3-5-16)17(21)12-18-10-14(17)11-19-8-6-15(20)7-9-19/h2-5,14-15,18,20-21H,6-12H2,1H3/t14-,17-/m0/s1 |
| InChIKey | CCZJPAFVVBZZAQ-YOEHRIQHSA-N |
| XLogP | 0.56 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol?
The IUPAC name of 1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol (CID 141364615) is 1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol.
What is the SMILES notation for 1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol?
The canonical SMILES for 1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol is COc1ccc([C@@]2(O)CNC[C@H]2CN2CCC(O)CC2)cc1.
What is the InChIKey of 1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol?
The InChIKey is CCZJPAFVVBZZAQ-YOEHRIQHSA-N. The full InChI is InChI=1S/C17H26N2O3/c1-22-16-4-2-13(3-5-16)17(21)12-18-10-14(17)11-19-8-6-15(20)7-9-19/h2-5,14-15,18,20-21H,6-12H2,1H3/t14-,17-/m0/s1.
What are the key properties of 1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol?
1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol has a molecular weight of 306.41 g/mol, XLogP of 0.56, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(3S,4R)-4-hydroxy-4-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]piperidin-4-ol is sourced from PubChem (CID 141364615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).