C17H17NO2 — CID 141364621
N-deuterio-N-[(2S)-1-oxo-1,3-diphenylpropan-2-yl]acetamide (PubChem CID 141364621) has the molecular formula C17H17NO2 and a molecular weight of 268.33 g/mol. Its IUPAC name is N-deuterio-N-[(2S)-1-oxo-1,3-diphenylpropan-2-yl]acetamide.
| Compound Name | N-deuterio-N-[(2S)-1-oxo-1,3-diphenylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 141364621 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-deuterio-N-[(2S)-1-oxo-1,3-diphenylpropan-2-yl]acetamide |
| SMILES | [2H]N(C(C)=O)[C@@H](Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c1-13(19)18-16(12-14-8-4-2-5-9-14)17(20)15-10-6-3-7-11-15/h2-11,16H,12H2,1H3,(H,18,19)/t16-/m0/s1/i/hD |
| InChIKey | VAWLDLJCAOHWMX-OXNKVLSNSA-N |
| XLogP | 2.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |