C12H15N3O2 — CID 141365224
1-methyl-5-propan-2-yl-1,3,5-benzotriazepine-2,4-dione (PubChem CID 141365224) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 1-methyl-5-propan-2-yl-1,3,5-benzotriazepine-2,4-dione.
| Compound Name | 1-methyl-5-propan-2-yl-1,3,5-benzotriazepine-2,4-dione |
|---|---|
| PubChem CID | 141365224 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-methyl-5-propan-2-yl-1,3,5-benzotriazepine-2,4-dione |
| SMILES | CC(C)N1C(=O)NC(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C12H15N3O2/c1-8(2)15-10-7-5-4-6-9(10)14(3)11(16)13-12(15)17/h4-8H,1-3H3,(H,13,16,17) |
| InChIKey | KICLDQUDXABQQS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |