About 4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline
4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline (PubChem CID 141365871) has the molecular formula C24H14Br6N2O
and a molecular weight of 825.81 g/mol. Its IUPAC name is 4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline.
Molecular Properties
| Compound Name | 4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline |
| PubChem CID | 141365871 |
| Molecular Formula | C24H14Br6N2O |
| Molecular Weight | 825.81 g/mol |
| Exact Mass | 819.62 |
| IUPAC Name | 4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline |
| SMILES | Nc1ccc(-c2ccc(Br)c(Oc3c(Br)ccc(-c4ccc(N)cc4Br)c3Br)c2Br)c(Br)c1 |
| InChI | InChI=1S/C24H14Br6N2O/c25-17-7-5-15(13-3-1-11(31)9-19(13)27)21(29)23(17)33-24-18(26)8-6-16(22(24)30)14-4-2-12(32)10-20(14)28/h1-10H,31-32H2 |
| InChIKey | WOFOXKKNKFJUQR-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 825.81 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline?
The IUPAC name of 4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline (CID 141365871) is 4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline.
What is the SMILES notation for 4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline?
The canonical SMILES for 4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline is Nc1ccc(-c2ccc(Br)c(Oc3c(Br)ccc(-c4ccc(N)cc4Br)c3Br)c2Br)c(Br)c1.
What is the InChIKey of 4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline?
The InChIKey is WOFOXKKNKFJUQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14Br6N2O/c25-17-7-5-15(13-3-1-11(31)9-19(13)27)21(29)23(17)33-24-18(26)8-6-16(22(24)30)14-4-2-12(32)10-20(14)28/h1-10H,31-32H2.
What are the key properties of 4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline?
4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline has a molecular weight of 825.81 g/mol, XLogP of 10.55, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[3-(4-amino-2-bromophenyl)-2,6-dibromophenoxy]-2,4-dibromophenyl]-3-bromoaniline is sourced from PubChem (CID 141365871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).