C6CoF13- — CID 141365873
cobalt;1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorohexane (PubChem CID 141365873) has the molecular formula C6CoF13- and a molecular weight of 377.97 g/mol. Its IUPAC name is cobalt;1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorohexane.
| Compound Name | cobalt;1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorohexane |
|---|---|
| PubChem CID | 141365873 |
| Molecular Formula | C6CoF13- |
| Molecular Weight | 377.97 g/mol |
| Exact Mass | 377.91 |
| IUPAC Name | cobalt;1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorohexane |
| SMILES | F[C-](F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Co] |
| InChI | InChI=1S/C6F13.Co/c7-1(8)2(9,10)3(11,12)4(13,14)5(15,16)6(17,18)19;/q-1; |
| InChIKey | RXUAARZJXCUWBN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.97 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|