About 3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline
3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline (PubChem CID 141367138) has the molecular formula C23H24ClN3O
and a molecular weight of 393.92 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline.
Molecular Properties
| Compound Name | 3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline |
| PubChem CID | 141367138 |
| Molecular Formula | C23H24ClN3O |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline |
| SMILES | COc1cccc2c3c(cnc12)CN(c1cccc(Cl)c1)CN3C1CCCC1 |
| InChI | InChI=1S/C23H24ClN3O/c1-28-21-11-5-10-20-22(21)25-13-16-14-26(19-9-4-6-17(24)12-19)15-27(23(16)20)18-7-2-3-8-18/h4-6,9-13,18H,2-3,7-8,14-15H2,1H3 |
| InChIKey | PSSYIIAZCYWFMU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline?
The IUPAC name of 3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline (CID 141367138) is 3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline.
What is the SMILES notation for 3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline?
The canonical SMILES for 3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline is COc1cccc2c3c(cnc12)CN(c1cccc(Cl)c1)CN3C1CCCC1.
What is the InChIKey of 3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline?
The InChIKey is PSSYIIAZCYWFMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24ClN3O/c1-28-21-11-5-10-20-22(21)25-13-16-14-26(19-9-4-6-17(24)12-19)15-27(23(16)20)18-7-2-3-8-18/h4-6,9-13,18H,2-3,7-8,14-15H2,1H3.
What are the key properties of 3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline?
3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline has a molecular weight of 393.92 g/mol, XLogP of 5.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorophenyl)-1-cyclopentyl-7-methoxy-2,4-dihydropyrimido[5,4-c]quinoline is sourced from PubChem (CID 141367138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).