C14H12N4S — CID 141367438
5-pyridin-4-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene (PubChem CID 141367438) has the molecular formula C14H12N4S and a molecular weight of 268.34 g/mol. Its IUPAC name is 5-pyridin-4-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene.
| Compound Name | 5-pyridin-4-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene |
|---|---|
| PubChem CID | 141367438 |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5-pyridin-4-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene |
| SMILES | c1cc(-c2ncc3c4c(sc3n2)CNCC4)ccn1 |
| InChI | InChI=1S/C14H12N4S/c1-4-15-5-2-9(1)13-17-7-11-10-3-6-16-8-12(10)19-14(11)18-13/h1-2,4-5,7,16H,3,6,8H2 |
| InChIKey | SMPAIDYSKFVBCU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |