C9H13N5O2 — CID 141367991
4-(5-aminopyrazin-2-yl)piperazine-1-carboxylic acid (PubChem CID 141367991) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is 4-(5-aminopyrazin-2-yl)piperazine-1-carboxylic acid.
| Compound Name | 4-(5-aminopyrazin-2-yl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 141367991 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 4-(5-aminopyrazin-2-yl)piperazine-1-carboxylic acid |
| SMILES | Nc1cnc(N2CCN(C(=O)O)CC2)cn1 |
| InChI | InChI=1S/C9H13N5O2/c10-7-5-12-8(6-11-7)13-1-3-14(4-2-13)9(15)16/h5-6H,1-4H2,(H2,10,11)(H,15,16) |
| InChIKey | UQNYSVULSCBMJZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |