About 3-ethenoxybutan-2-yl prop-2-enoate
3-ethenoxybutan-2-yl prop-2-enoate (PubChem CID 141368584) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-ethenoxybutan-2-yl prop-2-enoate.
Molecular Properties
| Compound Name | 3-ethenoxybutan-2-yl prop-2-enoate |
| PubChem CID | 141368584 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 3-ethenoxybutan-2-yl prop-2-enoate |
| SMILES | C=COC(C)C(C)OC(=O)C=C |
| InChI | InChI=1S/C9H14O3/c1-5-9(10)12-8(4)7(3)11-6-2/h5-8H,1-2H2,3-4H3 |
| InChIKey | WITRHALQHDGRBJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenoxybutan-2-yl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenoxybutan-2-yl prop-2-enoate?
The IUPAC name of 3-ethenoxybutan-2-yl prop-2-enoate (CID 141368584) is 3-ethenoxybutan-2-yl prop-2-enoate.
What is the SMILES notation for 3-ethenoxybutan-2-yl prop-2-enoate?
The canonical SMILES for 3-ethenoxybutan-2-yl prop-2-enoate is C=COC(C)C(C)OC(=O)C=C.
What is the InChIKey of 3-ethenoxybutan-2-yl prop-2-enoate?
The InChIKey is WITRHALQHDGRBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-5-9(10)12-8(4)7(3)11-6-2/h5-8H,1-2H2,3-4H3.
What are the key properties of 3-ethenoxybutan-2-yl prop-2-enoate?
3-ethenoxybutan-2-yl prop-2-enoate has a molecular weight of 170.21 g/mol, XLogP of 1.65, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenoxybutan-2-yl prop-2-enoate is sourced from PubChem (CID 141368584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).