About 2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine
2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine (PubChem CID 141369929) has the molecular formula C11H14F2N4
and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine |
| PubChem CID | 141369929 |
| Molecular Formula | C11H14F2N4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1ncc2c(C(F)F)ccnc21 |
| InChI | InChI=1S/C11H14F2N4/c1-16(2)5-6-17-11-9(7-15-17)8(10(12)13)3-4-14-11/h3-4,7,10H,5-6H2,1-2H3 |
| InChIKey | JYTPXAZJZYQWCL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine (CID 141369929) is 2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine is CN(C)CCn1ncc2c(C(F)F)ccnc21.
What is the InChIKey of 2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine?
The InChIKey is JYTPXAZJZYQWCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2N4/c1-16(2)5-6-17-11-9(7-15-17)8(10(12)13)3-4-14-11/h3-4,7,10H,5-6H2,1-2H3.
What are the key properties of 2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine?
2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine has a molecular weight of 240.26 g/mol, XLogP of 1.93, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(difluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 141369929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).