C33H38N6O3 — CID 141371059
7-butyl-4-(2,2-dimethyloxan-4-yl)-2-methyl-6-[[3-(5-oxo-1,4-dihydropyrazol-3-yl)-4-phenylphenyl]methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-5-one (PubChem CID 141371059) has the molecular formula C33H38N6O3 and a molecular weight of 566.71 g/mol. Its IUPAC name is 7-butyl-4-(2,2-dimethyloxan-4-yl)-2-methyl-6-[[3-(5-oxo-1,4-dihydropyrazol-3-yl)-4-phenylphenyl]methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-5-one.
| Compound Name | 7-butyl-4-(2,2-dimethyloxan-4-yl)-2-methyl-6-[[3-(5-oxo-1,4-dihydropyrazol-3-yl)-4-phenylphenyl]methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 141371059 |
| Molecular Formula | C33H38N6O3 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 7-butyl-4-(2,2-dimethyloxan-4-yl)-2-methyl-6-[[3-(5-oxo-1,4-dihydropyrazol-3-yl)-4-phenylphenyl]methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
| SMILES | CCCCc1c(Cc2ccc(-c3ccccc3)c(C3=NNC(=O)C3)c2)c(=O)n(C2CCOC(C)(C)C2)c2nc(C)nn12 |
| InChI | InChI=1S/C33H38N6O3/c1-5-6-12-29-27(31(41)38(32-34-21(2)37-39(29)32)24-15-16-42-33(3,4)20-24)18-22-13-14-25(23-10-8-7-9-11-23)26(17-22)28-19-30(40)36-35-28/h7-11,13-14,17,24H,5-6,12,15-16,18-20H2,1-4H3,(H,36,40) |
| InChIKey | YMNPBDJVIYMWJW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |