C21H22F3NO2 — CID 141371737
N-ethyl-N-[[2-(2-methoxyphenyl)-5-(trifluoromethyl)phenyl]methyl]cyclopropanecarboxamide (PubChem CID 141371737) has the molecular formula C21H22F3NO2 and a molecular weight of 377.41 g/mol. Its IUPAC name is N-ethyl-N-[[2-(2-methoxyphenyl)-5-(trifluoromethyl)phenyl]methyl]cyclopropanecarboxamide.
| Compound Name | N-ethyl-N-[[2-(2-methoxyphenyl)-5-(trifluoromethyl)phenyl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 141371737 |
| Molecular Formula | C21H22F3NO2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-ethyl-N-[[2-(2-methoxyphenyl)-5-(trifluoromethyl)phenyl]methyl]cyclopropanecarboxamide |
| SMILES | CCN(Cc1cc(C(F)(F)F)ccc1-c1ccccc1OC)C(=O)C1CC1 |
| InChI | InChI=1S/C21H22F3NO2/c1-3-25(20(26)14-8-9-14)13-15-12-16(21(22,23)24)10-11-17(15)18-6-4-5-7-19(18)27-2/h4-7,10-12,14H,3,8-9,13H2,1-2H3 |
| InChIKey | RUPQJHGOZGSCIT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |