C27H29N7O3 — CID 141371781
2-[5-[[4-butyl-1-(5-methoxypyrimidin-2-yl)-2-methyl-6-oxopyrimidin-5-yl]methyl]-2-pyridinyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 141371781) has the molecular formula C27H29N7O3 and a molecular weight of 499.58 g/mol. Its IUPAC name is 2-[5-[[4-butyl-1-(5-methoxypyrimidin-2-yl)-2-methyl-6-oxopyrimidin-5-yl]methyl]-2-pyridinyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[5-[[4-butyl-1-(5-methoxypyrimidin-2-yl)-2-methyl-6-oxopyrimidin-5-yl]methyl]-2-pyridinyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 141371781 |
| Molecular Formula | C27H29N7O3 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 2-[5-[[4-butyl-1-(5-methoxypyrimidin-2-yl)-2-methyl-6-oxopyrimidin-5-yl]methyl]-2-pyridinyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | CCCCc1nc(C)n(-c2ncc(OC)cn2)c(=O)c1Cc1ccc(-c2ccccc2C(N)=NO)nc1 |
| InChI | InChI=1S/C27H29N7O3/c1-4-5-10-24-22(26(35)34(17(2)32-24)27-30-15-19(37-3)16-31-27)13-18-11-12-23(29-14-18)20-8-6-7-9-21(20)25(28)33-36/h6-9,11-12,14-16,36H,4-5,10,13H2,1-3H3,(H2,28,33) |
| InChIKey | KAQBLNKCNWFKIV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|