C19H4BF15O2 — CID 141371951
(2,3,4,5,6-pentafluoro-1-methylcyclohexa-2,4-dien-1-yl)-bis(2,3,4,5,6-pentafluorophenoxy)borane (PubChem CID 141371951) has the molecular formula C19H4BF15O2 and a molecular weight of 560.02 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluoro-1-methylcyclohexa-2,4-dien-1-yl)-bis(2,3,4,5,6-pentafluorophenoxy)borane.
| Compound Name | (2,3,4,5,6-pentafluoro-1-methylcyclohexa-2,4-dien-1-yl)-bis(2,3,4,5,6-pentafluorophenoxy)borane |
|---|---|
| PubChem CID | 141371951 |
| Molecular Formula | C19H4BF15O2 |
| Molecular Weight | 560.02 g/mol |
| Exact Mass | 560.01 |
| IUPAC Name | (2,3,4,5,6-pentafluoro-1-methylcyclohexa-2,4-dien-1-yl)-bis(2,3,4,5,6-pentafluorophenoxy)borane |
| SMILES | CC1(B(Oc2c(F)c(F)c(F)c(F)c2F)Oc2c(F)c(F)c(F)c(F)c2F)C(F)=C(F)C(F)=C(F)C1F |
| InChI | InChI=1S/C19H4BF15O2/c1-19(17(34)13(32)8(27)14(33)18(19)35)20(36-15-9(28)4(23)2(21)5(24)10(15)29)37-16-11(30)6(25)3(22)7(26)12(16)31/h17H,1H3 |
| InChIKey | FEPVLFOJQCGXPS-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.02 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|