About 2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole
2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole (PubChem CID 141372722) has the molecular formula C19H14F3N5
and a molecular weight of 369.35 g/mol. Its IUPAC name is 2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole.
Molecular Properties
| Compound Name | 2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole |
| PubChem CID | 141372722 |
| Molecular Formula | C19H14F3N5 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole |
| SMILES | FC(F)(F)C1(C(c2ccccc2)c2ncc3c(n2)[nH]c2ccccc23)NN1 |
| InChI | InChI=1S/C19H14F3N5/c20-19(21,22)18(26-27-18)15(11-6-2-1-3-7-11)17-23-10-13-12-8-4-5-9-14(12)24-16(13)25-17/h1-10,15,26-27H,(H,23,24,25) |
| InChIKey | ZKTUCTDFJFINRH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole?
The IUPAC name of 2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole (CID 141372722) is 2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole.
What is the SMILES notation for 2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole?
The canonical SMILES for 2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole is FC(F)(F)C1(C(c2ccccc2)c2ncc3c(n2)[nH]c2ccccc23)NN1.
What is the InChIKey of 2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole?
The InChIKey is ZKTUCTDFJFINRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3N5/c20-19(21,22)18(26-27-18)15(11-6-2-1-3-7-11)17-23-10-13-12-8-4-5-9-14(12)24-16(13)25-17/h1-10,15,26-27H,(H,23,24,25).
What are the key properties of 2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole?
2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole has a molecular weight of 369.35 g/mol, XLogP of 3.61, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[phenyl-[3-(trifluoromethyl)diaziridin-3-yl]methyl]-9H-pyrimido[4,5-b]indole is sourced from PubChem (CID 141372722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).