C22H22Cl3N3O3S — CID 141372834
N,N-dibutyl-4-(2,3,4-trichloro-5,6-dicyanophenoxy)benzenesulfonamide (PubChem CID 141372834) has the molecular formula C22H22Cl3N3O3S and a molecular weight of 514.86 g/mol. Its IUPAC name is N,N-dibutyl-4-(2,3,4-trichloro-5,6-dicyanophenoxy)benzenesulfonamide.
| Compound Name | N,N-dibutyl-4-(2,3,4-trichloro-5,6-dicyanophenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 141372834 |
| Molecular Formula | C22H22Cl3N3O3S |
| Molecular Weight | 514.86 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | N,N-dibutyl-4-(2,3,4-trichloro-5,6-dicyanophenoxy)benzenesulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(Oc2c(Cl)c(Cl)c(Cl)c(C#N)c2C#N)cc1 |
| InChI | InChI=1S/C22H22Cl3N3O3S/c1-3-5-11-28(12-6-4-2)32(29,30)16-9-7-15(8-10-16)31-22-18(14-27)17(13-26)19(23)20(24)21(22)25/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | MDODRHSJDAMLNU-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.86 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|