About [(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid
[(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid (PubChem CID 141373128) has the molecular formula C17H25F3N2O3Si
and a molecular weight of 390.48 g/mol. Its IUPAC name is [(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid.
Molecular Properties
| Compound Name | [(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid |
| PubChem CID | 141373128 |
| Molecular Formula | C17H25F3N2O3Si |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid |
| SMILES | C[Si](C)(C)CCN(C(=O)O)[C@@H]1CNC[C@H]1c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H25F3N2O3Si/c1-26(2,3)8-7-22(16(23)24)15-11-21-10-14(15)12-5-4-6-13(9-12)25-17(18,19)20/h4-6,9,14-15,21H,7-8,10-11H2,1-3H3,(H,23,24)/t14-,15+/m0/s1 |
| InChIKey | YBRTYOYNIIKYND-LSDHHAIUSA-N |
| XLogP | 3.96 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid?
The IUPAC name of [(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid (CID 141373128) is [(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid.
What is the SMILES notation for [(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid?
The canonical SMILES for [(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid is C[Si](C)(C)CCN(C(=O)O)[C@@H]1CNC[C@H]1c1cccc(OC(F)(F)F)c1.
What is the InChIKey of [(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid?
The InChIKey is YBRTYOYNIIKYND-LSDHHAIUSA-N. The full InChI is InChI=1S/C17H25F3N2O3Si/c1-26(2,3)8-7-22(16(23)24)15-11-21-10-14(15)12-5-4-6-13(9-12)25-17(18,19)20/h4-6,9,14-15,21H,7-8,10-11H2,1-3H3,(H,23,24)/t14-,15+/m0/s1.
What are the key properties of [(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid?
[(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid has a molecular weight of 390.48 g/mol, XLogP of 3.96, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-(2-trimethylsilylethyl)carbamic acid is sourced from PubChem (CID 141373128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).